C8H8IN3O — CID 129261867
10-iodo-5-oxa-1,7,10-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene (PubChem CID 129261867) has the molecular formula C8H8IN3O and a molecular weight of 289.08 g/mol. Its IUPAC name is 10-iodo-5-oxa-1,7,10-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene.
| Compound Name | 10-iodo-5-oxa-1,7,10-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene |
|---|---|
| PubChem CID | 129261867 |
| Molecular Formula | C8H8IN3O |
| Molecular Weight | 289.08 g/mol |
| Exact Mass | 288.97 |
| IUPAC Name | 10-iodo-5-oxa-1,7,10-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene |
| SMILES | IN1CCn2c(nc3occc32)C1 |
| InChI | InChI=1S/C8H8IN3O/c9-11-2-3-12-6-1-4-13-8(6)10-7(12)5-11/h1,4H,2-3,5H2 |
| InChIKey | WDAJGVCBTDOOSS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 34.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.08 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|