C26H26FN7O4 — CID 129261988
7-[5-(2,8b-dihydro-1aH-oxireno[2,3-d][2,3]benzodiazepin-4-ylmethyl)-2-fluorobenzoyl]-N-(2-methoxyethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-3-carboxamide (PubChem CID 129261988) has the molecular formula C26H26FN7O4 and a molecular weight of 519.54 g/mol. Its IUPAC name is 7-[5-(2,8b-dihydro-1aH-oxireno[2,3-d][2,3]benzodiazepin-4-ylmethyl)-2-fluorobenzoyl]-N-(2-methoxyethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-3-carboxamide.
| Compound Name | 7-[5-(2,8b-dihydro-1aH-oxireno[2,3-d][2,3]benzodiazepin-4-ylmethyl)-2-fluorobenzoyl]-N-(2-methoxyethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 129261988 |
| Molecular Formula | C26H26FN7O4 |
| Molecular Weight | 519.54 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 7-[5-(2,8b-dihydro-1aH-oxireno[2,3-d][2,3]benzodiazepin-4-ylmethyl)-2-fluorobenzoyl]-N-(2-methoxyethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-3-carboxamide |
| SMILES | COCCNC(=O)c1nnc2n1CCN(C(=O)c1cc(CC3=NNC4OC4c4ccccc43)ccc1F)C2 |
| InChI | InChI=1S/C26H26FN7O4/c1-37-11-8-28-24(35)23-31-30-21-14-33(9-10-34(21)23)26(36)18-12-15(6-7-19(18)27)13-20-16-4-2-3-5-17(16)22-25(38-22)32-29-20/h2-7,12,22,25,32H,8-11,13-14H2,1H3,(H,28,35) |
| InChIKey | GZBKTDXJGUULAQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 126.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.54 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|