C11H17N3 — CID 129262022
7-methyl-6,6a,8,9,10,10a-hexahydro-5H-imidazo[2,1-f][1,6]naphthyridine (PubChem CID 129262022) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 7-methyl-6,6a,8,9,10,10a-hexahydro-5H-imidazo[2,1-f][1,6]naphthyridine.
| Compound Name | 7-methyl-6,6a,8,9,10,10a-hexahydro-5H-imidazo[2,1-f][1,6]naphthyridine |
|---|---|
| PubChem CID | 129262022 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 7-methyl-6,6a,8,9,10,10a-hexahydro-5H-imidazo[2,1-f][1,6]naphthyridine |
| SMILES | CN1CCCC2c3nccn3CCC21 |
| InChI | InChI=1S/C11H17N3/c1-13-6-2-3-9-10(13)4-7-14-8-5-12-11(9)14/h5,8-10H,2-4,6-7H2,1H3 |
| InChIKey | MSGMOBOLYZNODU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |