C12H18N2 — CID 129262052
4-methyl-2,3,4a,5,6,10b-hexahydro-1H-pyrrolo[2,1-f][1,6]naphthyridine (PubChem CID 129262052) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 4-methyl-2,3,4a,5,6,10b-hexahydro-1H-pyrrolo[2,1-f][1,6]naphthyridine.
| Compound Name | 4-methyl-2,3,4a,5,6,10b-hexahydro-1H-pyrrolo[2,1-f][1,6]naphthyridine |
|---|---|
| PubChem CID | 129262052 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 4-methyl-2,3,4a,5,6,10b-hexahydro-1H-pyrrolo[2,1-f][1,6]naphthyridine |
| SMILES | CN1CCCC2c3cccn3CCC21 |
| InChI | InChI=1S/C12H18N2/c1-13-7-2-4-10-11(13)6-9-14-8-3-5-12(10)14/h3,5,8,10-11H,2,4,6-7,9H2,1H3 |
| InChIKey | XIPNZGZGULASPM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |