C7H11N5 — CID 129262068
1,2,5,6,10-pentazatricyclo[6.4.0.02,6]dodeca-4,7-diene (PubChem CID 129262068) has the molecular formula C7H11N5 and a molecular weight of 165.20 g/mol. Its IUPAC name is 1,2,5,6,10-pentazatricyclo[6.4.0.02,6]dodeca-4,7-diene.
| Compound Name | 1,2,5,6,10-pentazatricyclo[6.4.0.02,6]dodeca-4,7-diene |
|---|---|
| PubChem CID | 129262068 |
| Molecular Formula | C7H11N5 |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 1,2,5,6,10-pentazatricyclo[6.4.0.02,6]dodeca-4,7-diene |
| SMILES | C1=NN2C=C3CNCCN3N2C1 |
| InChI | InChI=1S/C7H11N5/c1-3-10-7(5-8-1)6-11-9-2-4-12(10)11/h2,6,8H,1,3-5H2 |
| InChIKey | APZRBOBLZHVMKG-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |