C21H25N3 — CID 129262154
4-(2,3-dimethyl-5-phenylimidazol-4-yl)-5,6,7,8,9,9a-hexahydro-4aH-cyclohepta[b]pyridine (PubChem CID 129262154) has the molecular formula C21H25N3 and a molecular weight of 319.45 g/mol. Its IUPAC name is 4-(2,3-dimethyl-5-phenylimidazol-4-yl)-5,6,7,8,9,9a-hexahydro-4aH-cyclohepta[b]pyridine.
| Compound Name | 4-(2,3-dimethyl-5-phenylimidazol-4-yl)-5,6,7,8,9,9a-hexahydro-4aH-cyclohepta[b]pyridine |
|---|---|
| PubChem CID | 129262154 |
| Molecular Formula | C21H25N3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 4-(2,3-dimethyl-5-phenylimidazol-4-yl)-5,6,7,8,9,9a-hexahydro-4aH-cyclohepta[b]pyridine |
| SMILES | Cc1nc(-c2ccccc2)c(C2=CC=NC3CCCCCC23)n1C |
| InChI | InChI=1S/C21H25N3/c1-15-23-20(16-9-5-3-6-10-16)21(24(15)2)18-13-14-22-19-12-8-4-7-11-17(18)19/h3,5-6,9-10,13-14,17,19H,4,7-8,11-12H2,1-2H3 |
| InChIKey | DEFBGSILCAWHPX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |