C31H40O11 — CID 129262192
[(1R,2R,3S,5R,8S,9R,13S)-8-acetyloxy-7-ethoxy-2,2',2',9,13-pentamethyl-6,16-dimethylidene-6',11,15-trioxospiro[10,14-dioxatetracyclo[7.6.1.01,12.02,7]hexadecane-5,3'-oxane]-3-yl] acetate (PubChem CID 129262192) has the molecular formula C31H40O11 and a molecular weight of 588.65 g/mol. Its IUPAC name is [(1R,2R,3S,5R,8S,9R,13S)-8-acetyloxy-7-ethoxy-2,2',2',9,13-pentamethyl-6,16-dimethylidene-6',11,15-trioxospiro[10,14-dioxatetracyclo[7.6.1.01,12.02,7]hexadecane-5,3'-oxane]-3-yl] acetate.
| Compound Name | [(1R,2R,3S,5R,8S,9R,13S)-8-acetyloxy-7-ethoxy-2,2',2',9,13-pentamethyl-6,16-dimethylidene-6',11,15-trioxospiro[10,14-dioxatetracyclo[7.6.1.01,12.02,7]hexadecane-5,3'-oxane]-3-yl] acetate |
|---|---|
| PubChem CID | 129262192 |
| Molecular Formula | C31H40O11 |
| Molecular Weight | 588.65 g/mol |
| Exact Mass | 588.26 |
| IUPAC Name | [(1R,2R,3S,5R,8S,9R,13S)-8-acetyloxy-7-ethoxy-2,2',2',9,13-pentamethyl-6,16-dimethylidene-6',11,15-trioxospiro[10,14-dioxatetracyclo[7.6.1.01,12.02,7]hexadecane-5,3'-oxane]-3-yl] acetate |
| SMILES | C=C1C2(OCC)[C@@H](OC(C)=O)[C@]3(C)OC(=O)C4[C@H](C)OC(=O)[C@]4(C3=C)[C@]2(C)[C@@H](OC(C)=O)C[C@]12CCC(=O)OC2(C)C |
| InChI | InChI=1S/C31H40O11/c1-11-37-31-17(4)29(13-12-21(34)41-26(29,7)8)14-20(39-18(5)32)28(31,10)30-16(3)27(9,24(31)40-19(6)33)42-23(35)22(30)15(2)38-25(30)36/h15,20,22,24H,3-4,11-14H2,1-2,5-10H3/t15-,20-,22?,24-,27+,28-,29+,30+,31?/m0/s1 |
| InChIKey | CJTDUSDQDNNCEQ-IZMANZCESA-N |
| XLogP | 3.13 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.65 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|