About 2-[[(2E,4Z)-hepta-2,4-dien-3-yl]-[2-(methylamino)ethyl]amino]ethanol
2-[[(2E,4Z)-hepta-2,4-dien-3-yl]-[2-(methylamino)ethyl]amino]ethanol (PubChem CID 129262282) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is 2-[[(2E,4Z)-hepta-2,4-dien-3-yl]-[2-(methylamino)ethyl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[[(2E,4Z)-hepta-2,4-dien-3-yl]-[2-(methylamino)ethyl]amino]ethanol |
| PubChem CID | 129262282 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 2-[[(2E,4Z)-hepta-2,4-dien-3-yl]-[2-(methylamino)ethyl]amino]ethanol |
| SMILES | C/C=C(\C=C/CC)N(CCO)CCNC |
| InChI | InChI=1S/C12H24N2O/c1-4-6-7-12(5-2)14(10-11-15)9-8-13-3/h5-7,13,15H,4,8-11H2,1-3H3/b7-6-,12-5+ |
| InChIKey | HOUUHIZGPACVOZ-BZNMCICSSA-N |
| XLogP | 1.37 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(2E,4Z)-hepta-2,4-dien-3-yl]-[2-(methylamino)ethyl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2E,4Z)-hepta-2,4-dien-3-yl]-[2-(methylamino)ethyl]amino]ethanol?
The IUPAC name of 2-[[(2E,4Z)-hepta-2,4-dien-3-yl]-[2-(methylamino)ethyl]amino]ethanol (CID 129262282) is 2-[[(2E,4Z)-hepta-2,4-dien-3-yl]-[2-(methylamino)ethyl]amino]ethanol.
What is the SMILES notation for 2-[[(2E,4Z)-hepta-2,4-dien-3-yl]-[2-(methylamino)ethyl]amino]ethanol?
The canonical SMILES for 2-[[(2E,4Z)-hepta-2,4-dien-3-yl]-[2-(methylamino)ethyl]amino]ethanol is C/C=C(\C=C/CC)N(CCO)CCNC.
What is the InChIKey of 2-[[(2E,4Z)-hepta-2,4-dien-3-yl]-[2-(methylamino)ethyl]amino]ethanol?
The InChIKey is HOUUHIZGPACVOZ-BZNMCICSSA-N. The full InChI is InChI=1S/C12H24N2O/c1-4-6-7-12(5-2)14(10-11-15)9-8-13-3/h5-7,13,15H,4,8-11H2,1-3H3/b7-6-,12-5+.
What are the key properties of 2-[[(2E,4Z)-hepta-2,4-dien-3-yl]-[2-(methylamino)ethyl]amino]ethanol?
2-[[(2E,4Z)-hepta-2,4-dien-3-yl]-[2-(methylamino)ethyl]amino]ethanol has a molecular weight of 212.34 g/mol, XLogP of 1.37, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2E,4Z)-hepta-2,4-dien-3-yl]-[2-(methylamino)ethyl]amino]ethanol is sourced from PubChem (CID 129262282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).