About (Z)-N,N-dimethyl-2-(2-methylhydrazinyl)ethenamine
(Z)-N,N-dimethyl-2-(2-methylhydrazinyl)ethenamine (PubChem CID 129262327) has the molecular formula C5H13N3
and a molecular weight of 115.18 g/mol. Its IUPAC name is (Z)-N,N-dimethyl-2-(2-methylhydrazinyl)ethenamine.
Molecular Properties
| Compound Name | (Z)-N,N-dimethyl-2-(2-methylhydrazinyl)ethenamine |
| PubChem CID | 129262327 |
| Molecular Formula | C5H13N3 |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.11 |
| IUPAC Name | (Z)-N,N-dimethyl-2-(2-methylhydrazinyl)ethenamine |
| SMILES | CNN/C=C\N(C)C |
| InChI | InChI=1S/C5H13N3/c1-6-7-4-5-8(2)3/h4-7H,1-3H3/b5-4- |
| InChIKey | WLNOWCZCMWUJNU-PLNGDYQASA-N |
| XLogP | -0.26 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N,N-dimethyl-2-(2-methylhydrazinyl)ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N,N-dimethyl-2-(2-methylhydrazinyl)ethenamine?
The IUPAC name of (Z)-N,N-dimethyl-2-(2-methylhydrazinyl)ethenamine (CID 129262327) is (Z)-N,N-dimethyl-2-(2-methylhydrazinyl)ethenamine.
What is the SMILES notation for (Z)-N,N-dimethyl-2-(2-methylhydrazinyl)ethenamine?
The canonical SMILES for (Z)-N,N-dimethyl-2-(2-methylhydrazinyl)ethenamine is CNN/C=C\N(C)C.
What is the InChIKey of (Z)-N,N-dimethyl-2-(2-methylhydrazinyl)ethenamine?
The InChIKey is WLNOWCZCMWUJNU-PLNGDYQASA-N. The full InChI is InChI=1S/C5H13N3/c1-6-7-4-5-8(2)3/h4-7H,1-3H3/b5-4-.
What are the key properties of (Z)-N,N-dimethyl-2-(2-methylhydrazinyl)ethenamine?
(Z)-N,N-dimethyl-2-(2-methylhydrazinyl)ethenamine has a molecular weight of 115.18 g/mol, XLogP of -0.26, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,N-dimethyl-2-(2-methylhydrazinyl)ethenamine is sourced from PubChem (CID 129262327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).