C6H13N3 — CID 129262344
(1E,3Z)-2-(methylaminomethyl)buta-1,3-diene-1,4-diamine (PubChem CID 129262344) has the molecular formula C6H13N3 and a molecular weight of 127.19 g/mol. Its IUPAC name is (1E,3Z)-2-(methylaminomethyl)buta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-2-(methylaminomethyl)buta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 129262344 |
| Molecular Formula | C6H13N3 |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.11 |
| IUPAC Name | (1E,3Z)-2-(methylaminomethyl)buta-1,3-diene-1,4-diamine |
| SMILES | CNCC(/C=C\N)=C/N |
| InChI | InChI=1S/C6H13N3/c1-9-5-6(4-8)2-3-7/h2-4,9H,5,7-8H2,1H3/b3-2-,6-4+ |
| InChIKey | LGIGKTOPCIDXRK-MGLVMYNNSA-N |
| XLogP | -0.48 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|