C59H37N5 — CID 129262842
2'-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-15-phenylspiro[1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12,14-heptaene-8,9'-fluorene] (PubChem CID 129262842) has the molecular formula C59H37N5 and a molecular weight of 815.98 g/mol. Its IUPAC name is 2'-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-15-phenylspiro[1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12,14-heptaene-8,9'-fluorene].
| Compound Name | 2'-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-15-phenylspiro[1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12,14-heptaene-8,9'-fluorene] |
|---|---|
| PubChem CID | 129262842 |
| Molecular Formula | C59H37N5 |
| Molecular Weight | 815.98 g/mol |
| Exact Mass | 815.30 |
| IUPAC Name | 2'-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-15-phenylspiro[1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12,14-heptaene-8,9'-fluorene] |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4cccc(-c5ccc6c(c5)C5(c7ccccc7-6)c6ccccc6-n6c(-c7ccccc7)nc7cccc5c76)c4)c3)n2)cc1 |
| InChI | InChI=1S/C59H37N5/c1-4-17-38(18-5-1)55-61-56(39-19-6-2-7-20-39)63-57(62-55)45-26-15-25-43(36-45)41-23-14-24-42(35-41)44-33-34-47-46-27-10-11-28-48(46)59(51(47)37-44)49-29-12-13-32-53(49)64-54-50(59)30-16-31-52(54)60-58(64)40-21-8-3-9-22-40/h1-37H |
| InChIKey | CFEHVFRHZIAWLO-UHFFFAOYSA-N |
| XLogP | 13.89 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.98 |
| LogP ≤ 5 | 13.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |