C27H23N3 — CID 129263355
4,6-diphenyl-2-(4-phenylphenyl)-1,2,3,4-tetrahydro-1,3,5-triazine (PubChem CID 129263355) has the molecular formula C27H23N3 and a molecular weight of 389.50 g/mol. Its IUPAC name is 4,6-diphenyl-2-(4-phenylphenyl)-1,2,3,4-tetrahydro-1,3,5-triazine.
| Compound Name | 4,6-diphenyl-2-(4-phenylphenyl)-1,2,3,4-tetrahydro-1,3,5-triazine |
|---|---|
| PubChem CID | 129263355 |
| Molecular Formula | C27H23N3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 4,6-diphenyl-2-(4-phenylphenyl)-1,2,3,4-tetrahydro-1,3,5-triazine |
| SMILES | c1ccc(C2=NC(c3ccccc3)NC(c3ccc(-c4ccccc4)cc3)N2)cc1 |
| InChI | InChI=1S/C27H23N3/c1-4-10-20(11-5-1)21-16-18-24(19-17-21)27-29-25(22-12-6-2-7-13-22)28-26(30-27)23-14-8-3-9-15-23/h1-19,25,27,29H,(H,28,30) |
| InChIKey | USOQTZCEJJFHCN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |