C17H24F3N3O6S — CID 129263639
1-[(2R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[[3-methylbut-2-enyl-(2,2,2-trifluoro-1-hydroxyethyl)amino]methyl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 129263639) has the molecular formula C17H24F3N3O6S and a molecular weight of 455.46 g/mol. Its IUPAC name is 1-[(2R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[[3-methylbut-2-enyl-(2,2,2-trifluoro-1-hydroxyethyl)amino]methyl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-[(2R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[[3-methylbut-2-enyl-(2,2,2-trifluoro-1-hydroxyethyl)amino]methyl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 129263639 |
| Molecular Formula | C17H24F3N3O6S |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 1-[(2R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[[3-methylbut-2-enyl-(2,2,2-trifluoro-1-hydroxyethyl)amino]methyl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | CC(C)=CCN(Cc1cn([C@@H]2O[C@H](CO)C(O)C2O)c(=S)[nH]c1=O)C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24F3N3O6S/c1-8(2)3-4-22(15(28)17(18,19)20)5-9-6-23(16(30)21-13(9)27)14-12(26)11(25)10(7-24)29-14/h3,6,10-12,14-15,24-26,28H,4-5,7H2,1-2H3,(H,21,27,30)/t10-,11?,12?,14-,15?/m1/s1 |
| InChIKey | PPMOCRWQXHYCHI-VMXWRGAZSA-N |
| XLogP | 0.17 |
| TPSA | 131.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|