C17H26N6O3 — CID 129264747
(3S,4S)-5-[6-(2-amino-3-hydroxypropoxy)-3-pyridinyl]-3-propan-2-yl-4-(2H-tetrazol-5-yl)pent-1-en-2-ol (PubChem CID 129264747) has the molecular formula C17H26N6O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is (3S,4S)-5-[6-(2-amino-3-hydroxypropoxy)-3-pyridinyl]-3-propan-2-yl-4-(2H-tetrazol-5-yl)pent-1-en-2-ol.
| Compound Name | (3S,4S)-5-[6-(2-amino-3-hydroxypropoxy)-3-pyridinyl]-3-propan-2-yl-4-(2H-tetrazol-5-yl)pent-1-en-2-ol |
|---|---|
| PubChem CID | 129264747 |
| Molecular Formula | C17H26N6O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (3S,4S)-5-[6-(2-amino-3-hydroxypropoxy)-3-pyridinyl]-3-propan-2-yl-4-(2H-tetrazol-5-yl)pent-1-en-2-ol |
| SMILES | C=C(O)[C@@H](C(C)C)[C@H](Cc1ccc(OCC(N)CO)nc1)c1nn[nH]n1 |
| InChI | InChI=1S/C17H26N6O3/c1-10(2)16(11(3)25)14(17-20-22-23-21-17)6-12-4-5-15(19-7-12)26-9-13(18)8-24/h4-5,7,10,13-14,16,24-25H,3,6,8-9,18H2,1-2H3,(H,20,21,22,23)/t13?,14-,16+/m0/s1 |
| InChIKey | IRLXMMOHUXWTRR-JGKCFBKVSA-N |
| XLogP | 0.96 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|