C15H22N6O — CID 129264762
(3S,4S)-5-[6-(methylamino)-3-pyridinyl]-3-propan-2-yl-4-(2H-tetrazol-5-yl)pent-1-en-2-ol (PubChem CID 129264762) has the molecular formula C15H22N6O and a molecular weight of 302.38 g/mol. Its IUPAC name is (3S,4S)-5-[6-(methylamino)-3-pyridinyl]-3-propan-2-yl-4-(2H-tetrazol-5-yl)pent-1-en-2-ol.
| Compound Name | (3S,4S)-5-[6-(methylamino)-3-pyridinyl]-3-propan-2-yl-4-(2H-tetrazol-5-yl)pent-1-en-2-ol |
|---|---|
| PubChem CID | 129264762 |
| Molecular Formula | C15H22N6O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (3S,4S)-5-[6-(methylamino)-3-pyridinyl]-3-propan-2-yl-4-(2H-tetrazol-5-yl)pent-1-en-2-ol |
| SMILES | C=C(O)[C@@H](C(C)C)[C@H](Cc1ccc(NC)nc1)c1nn[nH]n1 |
| InChI | InChI=1S/C15H22N6O/c1-9(2)14(10(3)22)12(15-18-20-21-19-15)7-11-5-6-13(16-4)17-8-11/h5-6,8-9,12,14,22H,3,7H2,1-2,4H3,(H,16,17)(H,18,19,20,21)/t12-,14+/m0/s1 |
| InChIKey | TZHZJAJTAQZKAV-GXTWGEPZSA-N |
| XLogP | 2.31 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|