C48H33N5 — CID 129264991
2-[10-[4-(4,6-dipyridin-4-yl-2-pyridinyl)phenyl]anthracen-9-yl]-9,9-dimethylindeno[2,1-d]pyrimidine (PubChem CID 129264991) has the molecular formula C48H33N5 and a molecular weight of 679.83 g/mol. Its IUPAC name is 2-[10-[4-(4,6-dipyridin-4-yl-2-pyridinyl)phenyl]anthracen-9-yl]-9,9-dimethylindeno[2,1-d]pyrimidine.
| Compound Name | 2-[10-[4-(4,6-dipyridin-4-yl-2-pyridinyl)phenyl]anthracen-9-yl]-9,9-dimethylindeno[2,1-d]pyrimidine |
|---|---|
| PubChem CID | 129264991 |
| Molecular Formula | C48H33N5 |
| Molecular Weight | 679.83 g/mol |
| Exact Mass | 679.27 |
| IUPAC Name | 2-[10-[4-(4,6-dipyridin-4-yl-2-pyridinyl)phenyl]anthracen-9-yl]-9,9-dimethylindeno[2,1-d]pyrimidine |
| SMILES | CC1(C)c2ccccc2-c2cnc(-c3c4ccccc4c(-c4ccc(-c5cc(-c6ccncc6)cc(-c6ccncc6)n5)cc4)c4ccccc34)nc21 |
| InChI | InChI=1S/C48H33N5/c1-48(2)41-14-8-7-9-35(41)40-29-51-47(53-46(40)48)45-38-12-5-3-10-36(38)44(37-11-4-6-13-39(37)45)33-17-15-31(16-18-33)42-27-34(30-19-23-49-24-20-30)28-43(52-42)32-21-25-50-26-22-32/h3-29H,1-2H3 |
| InChIKey | ZGQZWSPHTIAGHJ-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.83 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|