C48H31N5 — CID 129265006
2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-2-yl]-9,9-diphenylindeno[2,1-d]pyrimidine (PubChem CID 129265006) has the molecular formula C48H31N5 and a molecular weight of 677.81 g/mol. Its IUPAC name is 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-2-yl]-9,9-diphenylindeno[2,1-d]pyrimidine.
| Compound Name | 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-2-yl]-9,9-diphenylindeno[2,1-d]pyrimidine |
|---|---|
| PubChem CID | 129265006 |
| Molecular Formula | C48H31N5 |
| Molecular Weight | 677.81 g/mol |
| Exact Mass | 677.26 |
| IUPAC Name | 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-2-yl]-9,9-diphenylindeno[2,1-d]pyrimidine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4ccc(-c5ncc6c(n5)C(c5ccccc5)(c5ccccc5)c5ccccc5-6)cc4c3)n2)cc1 |
| InChI | InChI=1S/C48H31N5/c1-5-15-33(16-6-1)45-51-46(34-17-7-2-8-18-34)53-47(52-45)36-28-26-32-25-27-35(29-37(32)30-36)44-49-31-41-40-23-13-14-24-42(40)48(43(41)50-44,38-19-9-3-10-20-38)39-21-11-4-12-22-39/h1-31H |
| InChIKey | NANIOILLZLUREQ-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.81 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |