About (3E)-3-(5,5-dimethyl-4-quinolin-6-yloxolan-2-ylidene)-6-fluoro-1H-indol-2-one
(3E)-3-(5,5-dimethyl-4-quinolin-6-yloxolan-2-ylidene)-6-fluoro-1H-indol-2-one (PubChem CID 129265049) has the molecular formula C23H19FN2O2
and a molecular weight of 374.42 g/mol. Its IUPAC name is (3E)-3-(5,5-dimethyl-4-quinolin-6-yloxolan-2-ylidene)-6-fluoro-1H-indol-2-one.
Molecular Properties
| Compound Name | (3E)-3-(5,5-dimethyl-4-quinolin-6-yloxolan-2-ylidene)-6-fluoro-1H-indol-2-one |
| PubChem CID | 129265049 |
| Molecular Formula | C23H19FN2O2 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | (3E)-3-(5,5-dimethyl-4-quinolin-6-yloxolan-2-ylidene)-6-fluoro-1H-indol-2-one |
| SMILES | CC1(C)O/C(=C2/C(=O)Nc3cc(F)ccc32)CC1c1ccc2ncccc2c1 |
| InChI | InChI=1S/C23H19FN2O2/c1-23(2)17(13-5-8-18-14(10-13)4-3-9-25-18)12-20(28-23)21-16-7-6-15(24)11-19(16)26-22(21)27/h3-11,17H,12H2,1-2H3,(H,26,27)/b21-20+ |
| InChIKey | UQZORBYQWACUIL-QZQOTICOSA-N |
| XLogP | 5.02 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-(5,5-dimethyl-4-quinolin-6-yloxolan-2-ylidene)-6-fluoro-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-(5,5-dimethyl-4-quinolin-6-yloxolan-2-ylidene)-6-fluoro-1H-indol-2-one?
The IUPAC name of (3E)-3-(5,5-dimethyl-4-quinolin-6-yloxolan-2-ylidene)-6-fluoro-1H-indol-2-one (CID 129265049) is (3E)-3-(5,5-dimethyl-4-quinolin-6-yloxolan-2-ylidene)-6-fluoro-1H-indol-2-one.
What is the SMILES notation for (3E)-3-(5,5-dimethyl-4-quinolin-6-yloxolan-2-ylidene)-6-fluoro-1H-indol-2-one?
The canonical SMILES for (3E)-3-(5,5-dimethyl-4-quinolin-6-yloxolan-2-ylidene)-6-fluoro-1H-indol-2-one is CC1(C)O/C(=C2/C(=O)Nc3cc(F)ccc32)CC1c1ccc2ncccc2c1.
What is the InChIKey of (3E)-3-(5,5-dimethyl-4-quinolin-6-yloxolan-2-ylidene)-6-fluoro-1H-indol-2-one?
The InChIKey is UQZORBYQWACUIL-QZQOTICOSA-N. The full InChI is InChI=1S/C23H19FN2O2/c1-23(2)17(13-5-8-18-14(10-13)4-3-9-25-18)12-20(28-23)21-16-7-6-15(24)11-19(16)26-22(21)27/h3-11,17H,12H2,1-2H3,(H,26,27)/b21-20+.
What are the key properties of (3E)-3-(5,5-dimethyl-4-quinolin-6-yloxolan-2-ylidene)-6-fluoro-1H-indol-2-one?
(3E)-3-(5,5-dimethyl-4-quinolin-6-yloxolan-2-ylidene)-6-fluoro-1H-indol-2-one has a molecular weight of 374.42 g/mol, XLogP of 5.02, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-(5,5-dimethyl-4-quinolin-6-yloxolan-2-ylidene)-6-fluoro-1H-indol-2-one is sourced from PubChem (CID 129265049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).