About S-methyl (2R,3S)-3-fluoro-2-methyldecanethioate
S-methyl (2R,3S)-3-fluoro-2-methyldecanethioate (PubChem CID 129265072) has the molecular formula C12H23FOS
and a molecular weight of 234.38 g/mol. Its IUPAC name is S-methyl (2R,3S)-3-fluoro-2-methyldecanethioate.
Molecular Properties
| Compound Name | S-methyl (2R,3S)-3-fluoro-2-methyldecanethioate |
| PubChem CID | 129265072 |
| Molecular Formula | C12H23FOS |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | S-methyl (2R,3S)-3-fluoro-2-methyldecanethioate |
| SMILES | CCCCCCC[C@H](F)[C@@H](C)C(=O)SC |
| InChI | InChI=1S/C12H23FOS/c1-4-5-6-7-8-9-11(13)10(2)12(14)15-3/h10-11H,4-9H2,1-3H3/t10-,11+/m1/s1 |
| InChIKey | HVAONGZXBXGSMS-MNOVXSKESA-N |
| XLogP | 4.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-methyl (2R,3S)-3-fluoro-2-methyldecanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-methyl (2R,3S)-3-fluoro-2-methyldecanethioate?
The IUPAC name of S-methyl (2R,3S)-3-fluoro-2-methyldecanethioate (CID 129265072) is S-methyl (2R,3S)-3-fluoro-2-methyldecanethioate.
What is the SMILES notation for S-methyl (2R,3S)-3-fluoro-2-methyldecanethioate?
The canonical SMILES for S-methyl (2R,3S)-3-fluoro-2-methyldecanethioate is CCCCCCC[C@H](F)[C@@H](C)C(=O)SC.
What is the InChIKey of S-methyl (2R,3S)-3-fluoro-2-methyldecanethioate?
The InChIKey is HVAONGZXBXGSMS-MNOVXSKESA-N. The full InChI is InChI=1S/C12H23FOS/c1-4-5-6-7-8-9-11(13)10(2)12(14)15-3/h10-11H,4-9H2,1-3H3/t10-,11+/m1/s1.
What are the key properties of S-methyl (2R,3S)-3-fluoro-2-methyldecanethioate?
S-methyl (2R,3S)-3-fluoro-2-methyldecanethioate has a molecular weight of 234.38 g/mol, XLogP of 4.21, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-methyl (2R,3S)-3-fluoro-2-methyldecanethioate is sourced from PubChem (CID 129265072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).