C81H54N4 — CID 129265295
5-[3-[4,6-bis[3-(3,5-diphenylphenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]-3,9-diphenylcarbazole (PubChem CID 129265295) has the molecular formula C81H54N4 and a molecular weight of 1083.35 g/mol. Its IUPAC name is 5-[3-[4,6-bis[3-(3,5-diphenylphenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]-3,9-diphenylcarbazole.
| Compound Name | 5-[3-[4,6-bis[3-(3,5-diphenylphenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]-3,9-diphenylcarbazole |
|---|---|
| PubChem CID | 129265295 |
| Molecular Formula | C81H54N4 |
| Molecular Weight | 1083.35 g/mol |
| Exact Mass | 1082.43 |
| IUPAC Name | 5-[3-[4,6-bis[3-(3,5-diphenylphenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]-3,9-diphenylcarbazole |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3cccc(-c4nc(-c5cccc(-c6cc(-c7ccccc7)cc(-c7ccccc7)c6)c5)nc(-c5cccc(-c6cccc7c6c6cc(-c8ccccc8)ccc6n7-c6ccccc6)c5)n4)c3)c2)cc1 |
| InChI | InChI=1S/C81H54N4/c1-7-23-55(24-8-1)62-43-44-76-75(54-62)78-74(41-22-42-77(78)85(76)73-39-17-6-18-40-73)63-35-21-38-66(47-63)81-83-79(64-36-19-33-60(45-64)71-50-67(56-25-9-2-10-26-56)48-68(51-71)57-27-11-3-12-28-57)82-80(84-81)65-37-20-34-61(46-65)72-52-69(58-29-13-4-14-30-58)49-70(53-72)59-31-15-5-16-32-59/h1-54H |
| InChIKey | CAFNOYRJXJICHF-UHFFFAOYSA-N |
| XLogP | 21.31 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1083.35 |
| LogP ≤ 5 | 21.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |