C22H29F3O9S — CID 129266079
[(6R,7R,8S)-8,12-diethoxy-2-hydroxy-3,7,11-trimethyl-5,14-dioxo-13-oxatetracyclo[5.5.3.01,8.02,6]pentadec-3-en-4-yl] trifluoromethanesulfonate (PubChem CID 129266079) has the molecular formula C22H29F3O9S and a molecular weight of 526.53 g/mol. Its IUPAC name is [(6R,7R,8S)-8,12-diethoxy-2-hydroxy-3,7,11-trimethyl-5,14-dioxo-13-oxatetracyclo[5.5.3.01,8.02,6]pentadec-3-en-4-yl] trifluoromethanesulfonate.
| Compound Name | [(6R,7R,8S)-8,12-diethoxy-2-hydroxy-3,7,11-trimethyl-5,14-dioxo-13-oxatetracyclo[5.5.3.01,8.02,6]pentadec-3-en-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 129266079 |
| Molecular Formula | C22H29F3O9S |
| Molecular Weight | 526.53 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | [(6R,7R,8S)-8,12-diethoxy-2-hydroxy-3,7,11-trimethyl-5,14-dioxo-13-oxatetracyclo[5.5.3.01,8.02,6]pentadec-3-en-4-yl] trifluoromethanesulfonate |
| SMILES | CCOC1C(C)CC[C@@]2(OCC)C13OC(=O)C[C@]2(C)[C@H]1C(=O)C(OS(=O)(=O)C(F)(F)F)=C(C)C13O |
| InChI | InChI=1S/C22H29F3O9S/c1-6-31-17-11(3)8-9-19(32-7-2)18(5)10-13(26)33-21(17,19)20(28)12(4)15(14(27)16(18)20)34-35(29,30)22(23,24)25/h11,16-17,28H,6-10H2,1-5H3/t11?,16-,17?,18-,19+,20?,21?/m1/s1 |
| InChIKey | ZKYDBXUKKQVFMW-XYADGGDZSA-N |
| XLogP | 2.37 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.53 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|