About 4-hydroxy-1,3-dihydrobenzimidazol-2-one
4-hydroxy-1,3-dihydrobenzimidazol-2-one (PubChem CID 12926629) has the molecular formula C7H6N2O2
and a molecular weight of 150.14 g/mol. Its IUPAC name is 4-hydroxy-1,3-dihydrobenzimidazol-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-1,3-dihydrobenzimidazol-2-one |
| PubChem CID | 12926629 |
| Molecular Formula | C7H6N2O2 |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | 4-hydroxy-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2cccc(O)c2[nH]1 |
| InChI | InChI=1S/C7H6N2O2/c10-5-3-1-2-4-6(5)9-7(11)8-4/h1-3,10H,(H2,8,9,11) |
| InChIKey | CPBGGIHYAYWNDD-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-hydroxy-1,3-dihydrobenzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-1,3-dihydrobenzimidazol-2-one?
The IUPAC name of 4-hydroxy-1,3-dihydrobenzimidazol-2-one (CID 12926629) is 4-hydroxy-1,3-dihydrobenzimidazol-2-one.
What is the SMILES notation for 4-hydroxy-1,3-dihydrobenzimidazol-2-one?
The canonical SMILES for 4-hydroxy-1,3-dihydrobenzimidazol-2-one is O=c1[nH]c2cccc(O)c2[nH]1.
What is the InChIKey of 4-hydroxy-1,3-dihydrobenzimidazol-2-one?
The InChIKey is CPBGGIHYAYWNDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O2/c10-5-3-1-2-4-6(5)9-7(11)8-4/h1-3,10H,(H2,8,9,11).
What are the key properties of 4-hydroxy-1,3-dihydrobenzimidazol-2-one?
4-hydroxy-1,3-dihydrobenzimidazol-2-one has a molecular weight of 150.14 g/mol, XLogP of 0.56, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-1,3-dihydrobenzimidazol-2-one is sourced from PubChem (CID 12926629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).