C30H31N7O2 — CID 129266312
1-[6-[4-(4-acetylpiperazin-1-yl)anilino]-4-[(3-pyridin-2-ylphenyl)methylamino]pyridazin-3-yl]ethanone (PubChem CID 129266312) has the molecular formula C30H31N7O2 and a molecular weight of 521.63 g/mol. Its IUPAC name is 1-[6-[4-(4-acetylpiperazin-1-yl)anilino]-4-[(3-pyridin-2-ylphenyl)methylamino]pyridazin-3-yl]ethanone.
| Compound Name | 1-[6-[4-(4-acetylpiperazin-1-yl)anilino]-4-[(3-pyridin-2-ylphenyl)methylamino]pyridazin-3-yl]ethanone |
|---|---|
| PubChem CID | 129266312 |
| Molecular Formula | C30H31N7O2 |
| Molecular Weight | 521.63 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | 1-[6-[4-(4-acetylpiperazin-1-yl)anilino]-4-[(3-pyridin-2-ylphenyl)methylamino]pyridazin-3-yl]ethanone |
| SMILES | CC(=O)c1nnc(Nc2ccc(N3CCN(C(C)=O)CC3)cc2)cc1NCc1cccc(-c2ccccn2)c1 |
| InChI | InChI=1S/C30H31N7O2/c1-21(38)30-28(32-20-23-6-5-7-24(18-23)27-8-3-4-13-31-27)19-29(34-35-30)33-25-9-11-26(12-10-25)37-16-14-36(15-17-37)22(2)39/h3-13,18-19H,14-17,20H2,1-2H3,(H2,32,33,34) |
| InChIKey | LAEMXLCIZGQVSF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.63 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|