C22H24N4O2S3 — CID 129266587
4-[4-(aminomethoxymethyl)phenyl]-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-3-amine (PubChem CID 129266587) has the molecular formula C22H24N4O2S3 and a molecular weight of 472.66 g/mol. Its IUPAC name is 4-[4-(aminomethoxymethyl)phenyl]-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-3-amine.
| Compound Name | 4-[4-(aminomethoxymethyl)phenyl]-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-3-amine |
|---|---|
| PubChem CID | 129266587 |
| Molecular Formula | C22H24N4O2S3 |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 4-[4-(aminomethoxymethyl)phenyl]-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-3-amine |
| SMILES | CCCCS(=O)c1sc2nc(-c3nccs3)cc(-c3ccc(COCN)cc3)c2c1N |
| InChI | InChI=1S/C22H24N4O2S3/c1-2-3-10-31(27)22-19(24)18-16(15-6-4-14(5-7-15)12-28-13-23)11-17(26-21(18)30-22)20-25-8-9-29-20/h4-9,11H,2-3,10,12-13,23-24H2,1H3 |
| InChIKey | SKSZXUQYDOUXEZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|