About ethyl 2-[5-formyl-2,3-bis(4-methoxyphenyl)pyrrol-1-yl]acetate
ethyl 2-[5-formyl-2,3-bis(4-methoxyphenyl)pyrrol-1-yl]acetate (PubChem CID 129267334) has the molecular formula C23H23NO5
and a molecular weight of 393.44 g/mol. Its IUPAC name is ethyl 2-[5-formyl-2,3-bis(4-methoxyphenyl)pyrrol-1-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[5-formyl-2,3-bis(4-methoxyphenyl)pyrrol-1-yl]acetate |
| PubChem CID | 129267334 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | ethyl 2-[5-formyl-2,3-bis(4-methoxyphenyl)pyrrol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(C=O)cc(-c2ccc(OC)cc2)c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H23NO5/c1-4-29-22(26)14-24-18(15-25)13-21(16-5-9-19(27-2)10-6-16)23(24)17-7-11-20(28-3)12-8-17/h5-13,15H,4,14H2,1-3H3 |
| InChIKey | VEAPWIZMYQEYSN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[5-formyl-2,3-bis(4-methoxyphenyl)pyrrol-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[5-formyl-2,3-bis(4-methoxyphenyl)pyrrol-1-yl]acetate?
The IUPAC name of ethyl 2-[5-formyl-2,3-bis(4-methoxyphenyl)pyrrol-1-yl]acetate (CID 129267334) is ethyl 2-[5-formyl-2,3-bis(4-methoxyphenyl)pyrrol-1-yl]acetate.
What is the SMILES notation for ethyl 2-[5-formyl-2,3-bis(4-methoxyphenyl)pyrrol-1-yl]acetate?
The canonical SMILES for ethyl 2-[5-formyl-2,3-bis(4-methoxyphenyl)pyrrol-1-yl]acetate is CCOC(=O)Cn1c(C=O)cc(-c2ccc(OC)cc2)c1-c1ccc(OC)cc1.
What is the InChIKey of ethyl 2-[5-formyl-2,3-bis(4-methoxyphenyl)pyrrol-1-yl]acetate?
The InChIKey is VEAPWIZMYQEYSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23NO5/c1-4-29-22(26)14-24-18(15-25)13-21(16-5-9-19(27-2)10-6-16)23(24)17-7-11-20(28-3)12-8-17/h5-13,15H,4,14H2,1-3H3.
What are the key properties of ethyl 2-[5-formyl-2,3-bis(4-methoxyphenyl)pyrrol-1-yl]acetate?
ethyl 2-[5-formyl-2,3-bis(4-methoxyphenyl)pyrrol-1-yl]acetate has a molecular weight of 393.44 g/mol, XLogP of 4.21, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[5-formyl-2,3-bis(4-methoxyphenyl)pyrrol-1-yl]acetate is sourced from PubChem (CID 129267334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).