C23H23NO5 — CID 129267334
ethyl 2-[5-formyl-2,3-bis(4-methoxyphenyl)pyrrol-1-yl]acetate (PubChem CID 129267334) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is ethyl 2-[5-formyl-2,3-bis(4-methoxyphenyl)pyrrol-1-yl]acetate.
| Compound Name | ethyl 2-[5-formyl-2,3-bis(4-methoxyphenyl)pyrrol-1-yl]acetate |
|---|---|
| PubChem CID | 129267334 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | ethyl 2-[5-formyl-2,3-bis(4-methoxyphenyl)pyrrol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(C=O)cc(-c2ccc(OC)cc2)c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H23NO5/c1-4-29-22(26)14-24-18(15-25)13-21(16-5-9-19(27-2)10-6-16)23(24)17-7-11-20(28-3)12-8-17/h5-13,15H,4,14H2,1-3H3 |
| InChIKey | VEAPWIZMYQEYSN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|