C23H33NO4 — CID 129267761
2-(2,2-diethyl-3-methyl-3-propylhexyl)-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 129267761) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is 2-(2,2-diethyl-3-methyl-3-propylhexyl)-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-(2,2-diethyl-3-methyl-3-propylhexyl)-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 129267761 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | 2-(2,2-diethyl-3-methyl-3-propylhexyl)-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | CCCC(C)(CCC)C(CC)(CC)CN1C(=O)c2ccc(C(=O)O)cc2C1=O |
| InChI | InChI=1S/C23H33NO4/c1-6-12-22(5,13-7-2)23(8-3,9-4)15-24-19(25)17-11-10-16(21(27)28)14-18(17)20(24)26/h10-11,14H,6-9,12-13,15H2,1-5H3,(H,27,28) |
| InChIKey | BSFRLYYQMNWQAH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|