C23H28O — CID 129267856
1,3,4,5,6,7,8,9,10-nonamethylanthracen-2-ol (PubChem CID 129267856) has the molecular formula C23H28O and a molecular weight of 320.48 g/mol. Its IUPAC name is 1,3,4,5,6,7,8,9,10-nonamethylanthracen-2-ol.
| Compound Name | 1,3,4,5,6,7,8,9,10-nonamethylanthracen-2-ol |
|---|---|
| PubChem CID | 129267856 |
| Molecular Formula | C23H28O |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 1,3,4,5,6,7,8,9,10-nonamethylanthracen-2-ol |
| SMILES | Cc1c(C)c(C)c2c(C)c3c(C)c(O)c(C)c(C)c3c(C)c2c1C |
| InChI | InChI=1S/C23H28O/c1-10-11(2)13(4)20-17(8)22-18(9)23(24)15(6)14(5)21(22)16(7)19(20)12(10)3/h24H,1-9H3 |
| InChIKey | MWNFYHUAXCOCTQ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|