C26H27Cl2N5O4 — CID 129267960
methyl 2-[6-[[1-[(3,4-dichlorophenyl)methyl]-3,7-dimethyl-2,6-dioxo-4,5-dihydropurin-8-yl]amino]-2,3-dihydro-1H-inden-1-yl]acetate (PubChem CID 129267960) has the molecular formula C26H27Cl2N5O4 and a molecular weight of 544.44 g/mol. Its IUPAC name is methyl 2-[6-[[1-[(3,4-dichlorophenyl)methyl]-3,7-dimethyl-2,6-dioxo-4,5-dihydropurin-8-yl]amino]-2,3-dihydro-1H-inden-1-yl]acetate.
| Compound Name | methyl 2-[6-[[1-[(3,4-dichlorophenyl)methyl]-3,7-dimethyl-2,6-dioxo-4,5-dihydropurin-8-yl]amino]-2,3-dihydro-1H-inden-1-yl]acetate |
|---|---|
| PubChem CID | 129267960 |
| Molecular Formula | C26H27Cl2N5O4 |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | methyl 2-[6-[[1-[(3,4-dichlorophenyl)methyl]-3,7-dimethyl-2,6-dioxo-4,5-dihydropurin-8-yl]amino]-2,3-dihydro-1H-inden-1-yl]acetate |
| SMILES | COC(=O)CC1CCc2ccc(NC3=NC4C(C(=O)N(Cc5ccc(Cl)c(Cl)c5)C(=O)N4C)N3C)cc21 |
| InChI | InChI=1S/C26H27Cl2N5O4/c1-31-22-23(32(2)26(36)33(24(22)35)13-14-4-9-19(27)20(28)10-14)30-25(31)29-17-8-7-15-5-6-16(18(15)12-17)11-21(34)37-3/h4,7-10,12,16,22-23H,5-6,11,13H2,1-3H3,(H,29,30) |
| InChIKey | BGHCASBTVDGKFG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |