About 1-(1-tert-butylpiperidin-4-yl)-4,4-difluoro-3,5-dimethylpiperidine
1-(1-tert-butylpiperidin-4-yl)-4,4-difluoro-3,5-dimethylpiperidine (PubChem CID 129268293) has the molecular formula C16H30F2N2
and a molecular weight of 288.43 g/mol. Its IUPAC name is 1-(1-tert-butylpiperidin-4-yl)-4,4-difluoro-3,5-dimethylpiperidine.
Molecular Properties
| Compound Name | 1-(1-tert-butylpiperidin-4-yl)-4,4-difluoro-3,5-dimethylpiperidine |
| PubChem CID | 129268293 |
| Molecular Formula | C16H30F2N2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.24 |
| IUPAC Name | 1-(1-tert-butylpiperidin-4-yl)-4,4-difluoro-3,5-dimethylpiperidine |
| SMILES | CC1CN(C2CCN(C(C)(C)C)CC2)CC(C)C1(F)F |
| InChI | InChI=1S/C16H30F2N2/c1-12-10-19(11-13(2)16(12,17)18)14-6-8-20(9-7-14)15(3,4)5/h12-14H,6-11H2,1-5H3 |
| InChIKey | OEDGXDRCFLPAAT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1-tert-butylpiperidin-4-yl)-4,4-difluoro-3,5-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-tert-butylpiperidin-4-yl)-4,4-difluoro-3,5-dimethylpiperidine?
The IUPAC name of 1-(1-tert-butylpiperidin-4-yl)-4,4-difluoro-3,5-dimethylpiperidine (CID 129268293) is 1-(1-tert-butylpiperidin-4-yl)-4,4-difluoro-3,5-dimethylpiperidine.
What is the SMILES notation for 1-(1-tert-butylpiperidin-4-yl)-4,4-difluoro-3,5-dimethylpiperidine?
The canonical SMILES for 1-(1-tert-butylpiperidin-4-yl)-4,4-difluoro-3,5-dimethylpiperidine is CC1CN(C2CCN(C(C)(C)C)CC2)CC(C)C1(F)F.
What is the InChIKey of 1-(1-tert-butylpiperidin-4-yl)-4,4-difluoro-3,5-dimethylpiperidine?
The InChIKey is OEDGXDRCFLPAAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30F2N2/c1-12-10-19(11-13(2)16(12,17)18)14-6-8-20(9-7-14)15(3,4)5/h12-14H,6-11H2,1-5H3.
What are the key properties of 1-(1-tert-butylpiperidin-4-yl)-4,4-difluoro-3,5-dimethylpiperidine?
1-(1-tert-butylpiperidin-4-yl)-4,4-difluoro-3,5-dimethylpiperidine has a molecular weight of 288.43 g/mol, XLogP of 3.47, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-tert-butylpiperidin-4-yl)-4,4-difluoro-3,5-dimethylpiperidine is sourced from PubChem (CID 129268293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).