About 4-methoxy-3,8-di(propan-2-yl)-1,5-naphthyridine
4-methoxy-3,8-di(propan-2-yl)-1,5-naphthyridine (PubChem CID 129268497) has the molecular formula C15H20N2O
and a molecular weight of 244.34 g/mol. Its IUPAC name is 4-methoxy-3,8-di(propan-2-yl)-1,5-naphthyridine.
Molecular Properties
| Compound Name | 4-methoxy-3,8-di(propan-2-yl)-1,5-naphthyridine |
| PubChem CID | 129268497 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 4-methoxy-3,8-di(propan-2-yl)-1,5-naphthyridine |
| SMILES | COc1c(C(C)C)cnc2c(C(C)C)ccnc12 |
| InChI | InChI=1S/C15H20N2O/c1-9(2)11-6-7-16-14-13(11)17-8-12(10(3)4)15(14)18-5/h6-10H,1-5H3 |
| InChIKey | DPLFQPRGWMMCCE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxy-3,8-di(propan-2-yl)-1,5-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-3,8-di(propan-2-yl)-1,5-naphthyridine?
The IUPAC name of 4-methoxy-3,8-di(propan-2-yl)-1,5-naphthyridine (CID 129268497) is 4-methoxy-3,8-di(propan-2-yl)-1,5-naphthyridine.
What is the SMILES notation for 4-methoxy-3,8-di(propan-2-yl)-1,5-naphthyridine?
The canonical SMILES for 4-methoxy-3,8-di(propan-2-yl)-1,5-naphthyridine is COc1c(C(C)C)cnc2c(C(C)C)ccnc12.
What is the InChIKey of 4-methoxy-3,8-di(propan-2-yl)-1,5-naphthyridine?
The InChIKey is DPLFQPRGWMMCCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O/c1-9(2)11-6-7-16-14-13(11)17-8-12(10(3)4)15(14)18-5/h6-10H,1-5H3.
What are the key properties of 4-methoxy-3,8-di(propan-2-yl)-1,5-naphthyridine?
4-methoxy-3,8-di(propan-2-yl)-1,5-naphthyridine has a molecular weight of 244.34 g/mol, XLogP of 3.89, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-3,8-di(propan-2-yl)-1,5-naphthyridine is sourced from PubChem (CID 129268497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).