C54H37N5 — CID 129268600
4-phenyl-5-[4-[4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]phenyl]-3,5,9-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),3,7(12),10,13,15-heptaene (PubChem CID 129268600) has the molecular formula C54H37N5 and a molecular weight of 755.93 g/mol. Its IUPAC name is 4-phenyl-5-[4-[4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]phenyl]-3,5,9-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),3,7(12),10,13,15-heptaene.
| Compound Name | 4-phenyl-5-[4-[4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]phenyl]-3,5,9-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),3,7(12),10,13,15-heptaene |
|---|---|
| PubChem CID | 129268600 |
| Molecular Formula | C54H37N5 |
| Molecular Weight | 755.93 g/mol |
| Exact Mass | 755.30 |
| IUPAC Name | 4-phenyl-5-[4-[4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]phenyl]-3,5,9-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),3,7(12),10,13,15-heptaene |
| SMILES | C1=Cc2c(c3c(nc(-c4ccccc4)n3-c3ccc(-c4ccc(-c5cc(-c6ccc(-c7ccccc7)cc6)nc(-c6ccccc6)n5)cc4)cc3)c3ccccc23)CN1 |
| InChI | InChI=1S/C54H37N5/c1-4-12-36(13-5-1)37-20-24-40(25-21-37)49-34-50(57-53(56-49)42-14-6-2-7-15-42)41-26-22-38(23-27-41)39-28-30-44(31-29-39)59-52-48-35-55-33-32-46(48)45-18-10-11-19-47(45)51(52)58-54(59)43-16-8-3-9-17-43/h1-34,55H,35H2 |
| InChIKey | DUVLRWRXSBKHJV-UHFFFAOYSA-N |
| XLogP | 13.04 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.93 |
| LogP ≤ 5 | 13.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |