About 9,10-didehydro-1,2-dihydrobenzo[h]quinoline
9,10-didehydro-1,2-dihydrobenzo[h]quinoline (PubChem CID 129268922) has the molecular formula C13H9N
and a molecular weight of 179.22 g/mol. Its IUPAC name is 9,10-didehydro-1,2-dihydrobenzo[h]quinoline.
Molecular Properties
| Compound Name | 9,10-didehydro-1,2-dihydrobenzo[h]quinoline |
| PubChem CID | 129268922 |
| Molecular Formula | C13H9N |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 9,10-didehydro-1,2-dihydrobenzo[h]quinoline |
| SMILES | c1ccc2ccc3c(c2c#1)NCC=C3 |
| InChI | InChI=1S/C13H9N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1,3-5,7-8,14H,9H2 |
| InChIKey | JAUFSNXINYZVDK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9,10-didehydro-1,2-dihydrobenzo[h]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-didehydro-1,2-dihydrobenzo[h]quinoline?
The IUPAC name of 9,10-didehydro-1,2-dihydrobenzo[h]quinoline (CID 129268922) is 9,10-didehydro-1,2-dihydrobenzo[h]quinoline.
What is the SMILES notation for 9,10-didehydro-1,2-dihydrobenzo[h]quinoline?
The canonical SMILES for 9,10-didehydro-1,2-dihydrobenzo[h]quinoline is c1ccc2ccc3c(c2c#1)NCC=C3.
What is the InChIKey of 9,10-didehydro-1,2-dihydrobenzo[h]quinoline?
The InChIKey is JAUFSNXINYZVDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1,3-5,7-8,14H,9H2.
What are the key properties of 9,10-didehydro-1,2-dihydrobenzo[h]quinoline?
9,10-didehydro-1,2-dihydrobenzo[h]quinoline has a molecular weight of 179.22 g/mol, XLogP of 2.88, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-didehydro-1,2-dihydrobenzo[h]quinoline is sourced from PubChem (CID 129268922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).