C11H10BrN5O3 — CID 129268978
8-bromo-3,7-dimethyl-1-(1,3-oxazol-2-ylmethyl)purine-2,6-dione (PubChem CID 129268978) has the molecular formula C11H10BrN5O3 and a molecular weight of 340.14 g/mol. Its IUPAC name is 8-bromo-3,7-dimethyl-1-(1,3-oxazol-2-ylmethyl)purine-2,6-dione.
| Compound Name | 8-bromo-3,7-dimethyl-1-(1,3-oxazol-2-ylmethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 129268978 |
| Molecular Formula | C11H10BrN5O3 |
| Molecular Weight | 340.14 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | 8-bromo-3,7-dimethyl-1-(1,3-oxazol-2-ylmethyl)purine-2,6-dione |
| SMILES | Cn1c(Br)nc2c1c(=O)n(Cc1ncco1)c(=O)n2C |
| InChI | InChI=1S/C11H10BrN5O3/c1-15-7-8(14-10(15)12)16(2)11(19)17(9(7)18)5-6-13-3-4-20-6/h3-4H,5H2,1-2H3 |
| InChIKey | AATBNEMTNFPHAP-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 87.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.14 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |