C13H23NO4 — CID 129269186
ethyl 2-(2,2-dimethylpropanoyloxymethyl)-2-methyl-3-methyliminopropanoate (PubChem CID 129269186) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is ethyl 2-(2,2-dimethylpropanoyloxymethyl)-2-methyl-3-methyliminopropanoate.
| Compound Name | ethyl 2-(2,2-dimethylpropanoyloxymethyl)-2-methyl-3-methyliminopropanoate |
|---|---|
| PubChem CID | 129269186 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | ethyl 2-(2,2-dimethylpropanoyloxymethyl)-2-methyl-3-methyliminopropanoate |
| SMILES | CCOC(=O)C(C)(/C=N/C)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C13H23NO4/c1-7-17-11(16)13(5,8-14-6)9-18-10(15)12(2,3)4/h8H,7,9H2,1-6H3/b14-8+ |
| InChIKey | JFHYKTPMEMCUOA-RIYZIHGNSA-N |
| XLogP | 1.85 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|