C20H37N3 — CID 129269611
(1E)-1-N'-[1-[[3-[(Z)-but-2-en-2-yl]cyclohexyl]amino]propyl]-1-N,2,3-trimethylbuta-1,3-diene-1,1-diamine (PubChem CID 129269611) has the molecular formula C20H37N3 and a molecular weight of 319.54 g/mol. Its IUPAC name is (1E)-1-N'-[1-[[3-[(Z)-but-2-en-2-yl]cyclohexyl]amino]propyl]-1-N,2,3-trimethylbuta-1,3-diene-1,1-diamine.
| Compound Name | (1E)-1-N'-[1-[[3-[(Z)-but-2-en-2-yl]cyclohexyl]amino]propyl]-1-N,2,3-trimethylbuta-1,3-diene-1,1-diamine |
|---|---|
| PubChem CID | 129269611 |
| Molecular Formula | C20H37N3 |
| Molecular Weight | 319.54 g/mol |
| Exact Mass | 319.30 |
| IUPAC Name | (1E)-1-N'-[1-[[3-[(Z)-but-2-en-2-yl]cyclohexyl]amino]propyl]-1-N,2,3-trimethylbuta-1,3-diene-1,1-diamine |
| SMILES | C=C(C)/C(C)=C(\NC)NC(CC)NC1CCCC(/C(C)=C\C)C1 |
| InChI | InChI=1S/C20H37N3/c1-8-15(5)17-11-10-12-18(13-17)22-19(9-2)23-20(21-7)16(6)14(3)4/h8,17-19,21-23H,3,9-13H2,1-2,4-7H3/b15-8-,20-16+ |
| InChIKey | KTEQRAHHALJHLJ-HVINPANVSA-N |
| XLogP | 4.45 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|