About 2-methyl-5-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)sulfonyl]-1,3-thiazole
2-methyl-5-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)sulfonyl]-1,3-thiazole (PubChem CID 129269723) has the molecular formula C11H17N3O2S2
and a molecular weight of 287.41 g/mol. Its IUPAC name is 2-methyl-5-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)sulfonyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 2-methyl-5-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)sulfonyl]-1,3-thiazole |
| PubChem CID | 129269723 |
| Molecular Formula | C11H17N3O2S2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2-methyl-5-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)sulfonyl]-1,3-thiazole |
| SMILES | Cc1ncc(S(=O)(=O)N2C3CCC2CN(C)C3)s1 |
| InChI | InChI=1S/C11H17N3O2S2/c1-8-12-5-11(17-8)18(15,16)14-9-3-4-10(14)7-13(2)6-9/h5,9-10H,3-4,6-7H2,1-2H3 |
| InChIKey | BSBNHSFQFKHEIE-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-5-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)sulfonyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)sulfonyl]-1,3-thiazole?
The IUPAC name of 2-methyl-5-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)sulfonyl]-1,3-thiazole (CID 129269723) is 2-methyl-5-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)sulfonyl]-1,3-thiazole.
What is the SMILES notation for 2-methyl-5-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)sulfonyl]-1,3-thiazole?
The canonical SMILES for 2-methyl-5-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)sulfonyl]-1,3-thiazole is Cc1ncc(S(=O)(=O)N2C3CCC2CN(C)C3)s1.
What is the InChIKey of 2-methyl-5-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)sulfonyl]-1,3-thiazole?
The InChIKey is BSBNHSFQFKHEIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O2S2/c1-8-12-5-11(17-8)18(15,16)14-9-3-4-10(14)7-13(2)6-9/h5,9-10H,3-4,6-7H2,1-2H3.
What are the key properties of 2-methyl-5-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)sulfonyl]-1,3-thiazole?
2-methyl-5-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)sulfonyl]-1,3-thiazole has a molecular weight of 287.41 g/mol, XLogP of 0.92, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-[(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)sulfonyl]-1,3-thiazole is sourced from PubChem (CID 129269723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).