C28H40N10O3S — CID 129269881
2-[4-[[8-(8-cyclohexylsulfonyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]pyrazol-1-yl]-1-(4-methylpiperazin-1-yl)ethanone (PubChem CID 129269881) has the molecular formula C28H40N10O3S and a molecular weight of 596.76 g/mol. Its IUPAC name is 2-[4-[[8-(8-cyclohexylsulfonyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]pyrazol-1-yl]-1-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | 2-[4-[[8-(8-cyclohexylsulfonyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]pyrazol-1-yl]-1-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 129269881 |
| Molecular Formula | C28H40N10O3S |
| Molecular Weight | 596.76 g/mol |
| Exact Mass | 596.30 |
| IUPAC Name | 2-[4-[[8-(8-cyclohexylsulfonyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]pyrazol-1-yl]-1-(4-methylpiperazin-1-yl)ethanone |
| SMILES | CN1CCN(C(=O)Cn2cc(Nc3nc4c(N5CC6CCC(C5)N6S(=O)(=O)C5CCCCC5)cccn4n3)cn2)CC1 |
| InChI | InChI=1S/C28H40N10O3S/c1-33-12-14-34(15-13-33)26(39)20-36-17-21(16-29-36)30-28-31-27-25(8-5-11-37(27)32-28)35-18-22-9-10-23(19-35)38(22)42(40,41)24-6-3-2-4-7-24/h5,8,11,16-17,22-24H,2-4,6-7,9-10,12-15,18-20H2,1H3,(H,30,32) |
| InChIKey | AVSLREFZXRYLCN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 124.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.76 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |