About (3-iodo-3,8-diazabicyclo[3.2.1]octan-8-yl)-[3-(trifluoromethyl)azetidin-1-yl]methanone
(3-iodo-3,8-diazabicyclo[3.2.1]octan-8-yl)-[3-(trifluoromethyl)azetidin-1-yl]methanone (PubChem CID 129269977) has the molecular formula C11H15F3IN3O
and a molecular weight of 389.16 g/mol. Its IUPAC name is (3-iodo-3,8-diazabicyclo[3.2.1]octan-8-yl)-[3-(trifluoromethyl)azetidin-1-yl]methanone.
Molecular Properties
| Compound Name | (3-iodo-3,8-diazabicyclo[3.2.1]octan-8-yl)-[3-(trifluoromethyl)azetidin-1-yl]methanone |
| PubChem CID | 129269977 |
| Molecular Formula | C11H15F3IN3O |
| Molecular Weight | 389.16 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | (3-iodo-3,8-diazabicyclo[3.2.1]octan-8-yl)-[3-(trifluoromethyl)azetidin-1-yl]methanone |
| SMILES | O=C(N1CC(C(F)(F)F)C1)N1C2CCC1CN(I)C2 |
| InChI | InChI=1S/C11H15F3IN3O/c12-11(13,14)7-3-16(4-7)10(19)18-8-1-2-9(18)6-17(15)5-8/h7-9H,1-6H2 |
| InChIKey | IVWNROZFMMRUOD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.16 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze (3-iodo-3,8-diazabicyclo[3.2.1]octan-8-yl)-[3-(trifluoromethyl)azetidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-iodo-3,8-diazabicyclo[3.2.1]octan-8-yl)-[3-(trifluoromethyl)azetidin-1-yl]methanone?
The IUPAC name of (3-iodo-3,8-diazabicyclo[3.2.1]octan-8-yl)-[3-(trifluoromethyl)azetidin-1-yl]methanone (CID 129269977) is (3-iodo-3,8-diazabicyclo[3.2.1]octan-8-yl)-[3-(trifluoromethyl)azetidin-1-yl]methanone.
What is the SMILES notation for (3-iodo-3,8-diazabicyclo[3.2.1]octan-8-yl)-[3-(trifluoromethyl)azetidin-1-yl]methanone?
The canonical SMILES for (3-iodo-3,8-diazabicyclo[3.2.1]octan-8-yl)-[3-(trifluoromethyl)azetidin-1-yl]methanone is O=C(N1CC(C(F)(F)F)C1)N1C2CCC1CN(I)C2.
What is the InChIKey of (3-iodo-3,8-diazabicyclo[3.2.1]octan-8-yl)-[3-(trifluoromethyl)azetidin-1-yl]methanone?
The InChIKey is IVWNROZFMMRUOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F3IN3O/c12-11(13,14)7-3-16(4-7)10(19)18-8-1-2-9(18)6-17(15)5-8/h7-9H,1-6H2.
What are the key properties of (3-iodo-3,8-diazabicyclo[3.2.1]octan-8-yl)-[3-(trifluoromethyl)azetidin-1-yl]methanone?
(3-iodo-3,8-diazabicyclo[3.2.1]octan-8-yl)-[3-(trifluoromethyl)azetidin-1-yl]methanone has a molecular weight of 389.16 g/mol, XLogP of 2.10, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-iodo-3,8-diazabicyclo[3.2.1]octan-8-yl)-[3-(trifluoromethyl)azetidin-1-yl]methanone is sourced from PubChem (CID 129269977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).