C29H35FN10O2 — CID 129270112
2-[4-[[8-[(1S,5R)-8-[(6-fluoro-3-pyridinyl)methoxy]-3-azabicyclo[3.2.1]octan-3-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]pyrazol-1-yl]-1-(4-methylpiperazin-1-yl)ethanone (PubChem CID 129270112) has the molecular formula C29H35FN10O2 and a molecular weight of 574.67 g/mol. Its IUPAC name is 2-[4-[[8-[(1S,5R)-8-[(6-fluoro-3-pyridinyl)methoxy]-3-azabicyclo[3.2.1]octan-3-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]pyrazol-1-yl]-1-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | 2-[4-[[8-[(1S,5R)-8-[(6-fluoro-3-pyridinyl)methoxy]-3-azabicyclo[3.2.1]octan-3-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]pyrazol-1-yl]-1-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 129270112 |
| Molecular Formula | C29H35FN10O2 |
| Molecular Weight | 574.67 g/mol |
| Exact Mass | 574.29 |
| IUPAC Name | 2-[4-[[8-[(1S,5R)-8-[(6-fluoro-3-pyridinyl)methoxy]-3-azabicyclo[3.2.1]octan-3-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]pyrazol-1-yl]-1-(4-methylpiperazin-1-yl)ethanone |
| SMILES | CN1CCN(C(=O)Cn2cc(Nc3nc4c(N5C[C@H]6CC[C@@H](C5)C6OCc5ccc(F)nc5)cccn4n3)cn2)CC1 |
| InChI | InChI=1S/C29H35FN10O2/c1-36-9-11-37(12-10-36)26(41)18-39-17-23(14-32-39)33-29-34-28-24(3-2-8-40(28)35-29)38-15-21-5-6-22(16-38)27(21)42-19-20-4-7-25(30)31-13-20/h2-4,7-8,13-14,17,21-22,27H,5-6,9-12,15-16,18-19H2,1H3,(H,33,35)/t21-,22+,27? |
| InChIKey | JMNROVSWNBFLIA-RRZWQVKKSA-N |
| XLogP | 2.41 |
| TPSA | 108.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.67 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|