C24H24F2N4O3 — CID 129270240
N-[[4-(5-amino-1-cyclopentyl-4-formylpyrazol-3-yl)-3-fluorophenyl]methyl]-5-fluoro-2-methoxybenzamide (PubChem CID 129270240) has the molecular formula C24H24F2N4O3 and a molecular weight of 454.48 g/mol. Its IUPAC name is N-[[4-(5-amino-1-cyclopentyl-4-formylpyrazol-3-yl)-3-fluorophenyl]methyl]-5-fluoro-2-methoxybenzamide.
| Compound Name | N-[[4-(5-amino-1-cyclopentyl-4-formylpyrazol-3-yl)-3-fluorophenyl]methyl]-5-fluoro-2-methoxybenzamide |
|---|---|
| PubChem CID | 129270240 |
| Molecular Formula | C24H24F2N4O3 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | N-[[4-(5-amino-1-cyclopentyl-4-formylpyrazol-3-yl)-3-fluorophenyl]methyl]-5-fluoro-2-methoxybenzamide |
| SMILES | COc1ccc(F)cc1C(=O)NCc1ccc(-c2nn(C3CCCC3)c(N)c2C=O)c(F)c1 |
| InChI | InChI=1S/C24H24F2N4O3/c1-33-21-9-7-15(25)11-18(21)24(32)28-12-14-6-8-17(20(26)10-14)22-19(13-31)23(27)30(29-22)16-4-2-3-5-16/h6-11,13,16H,2-5,12,27H2,1H3,(H,28,32) |
| InChIKey | ZRYNZCGVGVQLFQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|