About 5-cyclohex-2-en-1-yl-2,3,4-trimethyl-4-(methylamino)pentanal
5-cyclohex-2-en-1-yl-2,3,4-trimethyl-4-(methylamino)pentanal (PubChem CID 129270612) has the molecular formula C15H27NO
and a molecular weight of 237.39 g/mol. Its IUPAC name is 5-cyclohex-2-en-1-yl-2,3,4-trimethyl-4-(methylamino)pentanal.
Molecular Properties
| Compound Name | 5-cyclohex-2-en-1-yl-2,3,4-trimethyl-4-(methylamino)pentanal |
| PubChem CID | 129270612 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 5-cyclohex-2-en-1-yl-2,3,4-trimethyl-4-(methylamino)pentanal |
| SMILES | CNC(C)(CC1C=CCCC1)C(C)C(C)C=O |
| InChI | InChI=1S/C15H27NO/c1-12(11-17)13(2)15(3,16-4)10-14-8-6-5-7-9-14/h6,8,11-14,16H,5,7,9-10H2,1-4H3 |
| InChIKey | GRQVBVLQCAOVCA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclohex-2-en-1-yl-2,3,4-trimethyl-4-(methylamino)pentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohex-2-en-1-yl-2,3,4-trimethyl-4-(methylamino)pentanal?
The IUPAC name of 5-cyclohex-2-en-1-yl-2,3,4-trimethyl-4-(methylamino)pentanal (CID 129270612) is 5-cyclohex-2-en-1-yl-2,3,4-trimethyl-4-(methylamino)pentanal.
What is the SMILES notation for 5-cyclohex-2-en-1-yl-2,3,4-trimethyl-4-(methylamino)pentanal?
The canonical SMILES for 5-cyclohex-2-en-1-yl-2,3,4-trimethyl-4-(methylamino)pentanal is CNC(C)(CC1C=CCCC1)C(C)C(C)C=O.
What is the InChIKey of 5-cyclohex-2-en-1-yl-2,3,4-trimethyl-4-(methylamino)pentanal?
The InChIKey is GRQVBVLQCAOVCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO/c1-12(11-17)13(2)15(3,16-4)10-14-8-6-5-7-9-14/h6,8,11-14,16H,5,7,9-10H2,1-4H3.
What are the key properties of 5-cyclohex-2-en-1-yl-2,3,4-trimethyl-4-(methylamino)pentanal?
5-cyclohex-2-en-1-yl-2,3,4-trimethyl-4-(methylamino)pentanal has a molecular weight of 237.39 g/mol, XLogP of 3.18, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohex-2-en-1-yl-2,3,4-trimethyl-4-(methylamino)pentanal is sourced from PubChem (CID 129270612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).