About [2-[(4S)-3,3-difluoro-4-hydroxypiperidin-1-yl]-2-oxoethyl] (2R)-2-aminopropanoate
[2-[(4S)-3,3-difluoro-4-hydroxypiperidin-1-yl]-2-oxoethyl] (2R)-2-aminopropanoate (PubChem CID 129270621) has the molecular formula C10H16F2N2O4
and a molecular weight of 266.24 g/mol. Its IUPAC name is [2-[(4S)-3,3-difluoro-4-hydroxypiperidin-1-yl]-2-oxoethyl] (2R)-2-aminopropanoate.
Molecular Properties
| Compound Name | [2-[(4S)-3,3-difluoro-4-hydroxypiperidin-1-yl]-2-oxoethyl] (2R)-2-aminopropanoate |
| PubChem CID | 129270621 |
| Molecular Formula | C10H16F2N2O4 |
| Molecular Weight | 266.24 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | [2-[(4S)-3,3-difluoro-4-hydroxypiperidin-1-yl]-2-oxoethyl] (2R)-2-aminopropanoate |
| SMILES | C[C@@H](N)C(=O)OCC(=O)N1CC[C@H](O)C(F)(F)C1 |
| InChI | InChI=1S/C10H16F2N2O4/c1-6(13)9(17)18-4-8(16)14-3-2-7(15)10(11,12)5-14/h6-7,15H,2-5,13H2,1H3/t6-,7+/m1/s1 |
| InChIKey | TXRZYCISAMGPLP-RQJHMYQMSA-N |
| XLogP | -0.89 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.24 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(4S)-3,3-difluoro-4-hydroxypiperidin-1-yl]-2-oxoethyl] (2R)-2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4S)-3,3-difluoro-4-hydroxypiperidin-1-yl]-2-oxoethyl] (2R)-2-aminopropanoate?
The IUPAC name of [2-[(4S)-3,3-difluoro-4-hydroxypiperidin-1-yl]-2-oxoethyl] (2R)-2-aminopropanoate (CID 129270621) is [2-[(4S)-3,3-difluoro-4-hydroxypiperidin-1-yl]-2-oxoethyl] (2R)-2-aminopropanoate.
What is the SMILES notation for [2-[(4S)-3,3-difluoro-4-hydroxypiperidin-1-yl]-2-oxoethyl] (2R)-2-aminopropanoate?
The canonical SMILES for [2-[(4S)-3,3-difluoro-4-hydroxypiperidin-1-yl]-2-oxoethyl] (2R)-2-aminopropanoate is C[C@@H](N)C(=O)OCC(=O)N1CC[C@H](O)C(F)(F)C1.
What is the InChIKey of [2-[(4S)-3,3-difluoro-4-hydroxypiperidin-1-yl]-2-oxoethyl] (2R)-2-aminopropanoate?
The InChIKey is TXRZYCISAMGPLP-RQJHMYQMSA-N. The full InChI is InChI=1S/C10H16F2N2O4/c1-6(13)9(17)18-4-8(16)14-3-2-7(15)10(11,12)5-14/h6-7,15H,2-5,13H2,1H3/t6-,7+/m1/s1.
What are the key properties of [2-[(4S)-3,3-difluoro-4-hydroxypiperidin-1-yl]-2-oxoethyl] (2R)-2-aminopropanoate?
[2-[(4S)-3,3-difluoro-4-hydroxypiperidin-1-yl]-2-oxoethyl] (2R)-2-aminopropanoate has a molecular weight of 266.24 g/mol, XLogP of -0.89, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4S)-3,3-difluoro-4-hydroxypiperidin-1-yl]-2-oxoethyl] (2R)-2-aminopropanoate is sourced from PubChem (CID 129270621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).