C21H21FN4O4 — CID 129270870
N-[4-[3-cyano-4-[3-fluoro-1-(2-methoxyacetyl)piperidin-4-yl]oxyphenyl]-2-pyridinyl]formamide (PubChem CID 129270870) has the molecular formula C21H21FN4O4 and a molecular weight of 412.42 g/mol. Its IUPAC name is N-[4-[3-cyano-4-[3-fluoro-1-(2-methoxyacetyl)piperidin-4-yl]oxyphenyl]-2-pyridinyl]formamide.
| Compound Name | N-[4-[3-cyano-4-[3-fluoro-1-(2-methoxyacetyl)piperidin-4-yl]oxyphenyl]-2-pyridinyl]formamide |
|---|---|
| PubChem CID | 129270870 |
| Molecular Formula | C21H21FN4O4 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | N-[4-[3-cyano-4-[3-fluoro-1-(2-methoxyacetyl)piperidin-4-yl]oxyphenyl]-2-pyridinyl]formamide |
| SMILES | COCC(=O)N1CCC(Oc2ccc(-c3ccnc(NC=O)c3)cc2C#N)C(F)C1 |
| InChI | InChI=1S/C21H21FN4O4/c1-29-12-21(28)26-7-5-19(17(22)11-26)30-18-3-2-14(8-16(18)10-23)15-4-6-24-20(9-15)25-13-27/h2-4,6,8-9,13,17,19H,5,7,11-12H2,1H3,(H,24,25,27) |
| InChIKey | LYNDVQYTHFJSGK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|