C28H37N5O8S — CID 129271363
(E)-3-[[(2S)-2-[[2-[[(2S)-2-formamidobutanoyl]amino]-3-quinolin-2-ylpropanoyl]amino]-3-methylbutanoyl]amino]-5-methylsulfonylpent-4-enoic acid (PubChem CID 129271363) has the molecular formula C28H37N5O8S and a molecular weight of 603.70 g/mol. Its IUPAC name is (E)-3-[[(2S)-2-[[2-[[(2S)-2-formamidobutanoyl]amino]-3-quinolin-2-ylpropanoyl]amino]-3-methylbutanoyl]amino]-5-methylsulfonylpent-4-enoic acid.
| Compound Name | (E)-3-[[(2S)-2-[[2-[[(2S)-2-formamidobutanoyl]amino]-3-quinolin-2-ylpropanoyl]amino]-3-methylbutanoyl]amino]-5-methylsulfonylpent-4-enoic acid |
|---|---|
| PubChem CID | 129271363 |
| Molecular Formula | C28H37N5O8S |
| Molecular Weight | 603.70 g/mol |
| Exact Mass | 603.24 |
| IUPAC Name | (E)-3-[[(2S)-2-[[2-[[(2S)-2-formamidobutanoyl]amino]-3-quinolin-2-ylpropanoyl]amino]-3-methylbutanoyl]amino]-5-methylsulfonylpent-4-enoic acid |
| SMILES | CC[C@H](NC=O)C(=O)NC(Cc1ccc2ccccc2n1)C(=O)N[C@H](C(=O)NC(/C=C/S(C)(=O)=O)CC(=O)O)C(C)C |
| InChI | InChI=1S/C28H37N5O8S/c1-5-21(29-16-34)26(37)32-23(14-19-11-10-18-8-6-7-9-22(18)30-19)27(38)33-25(17(2)3)28(39)31-20(15-24(35)36)12-13-42(4,40)41/h6-13,16-17,20-21,23,25H,5,14-15H2,1-4H3,(H,29,34)(H,31,39)(H,32,37)(H,33,38)(H,35,36)/b13-12+/t20?,21-,23?,25-/m0/s1 |
| InChIKey | FSSQUSWZNMLASU-GGXDWWBVSA-N |
| XLogP | 0.45 |
| TPSA | 200.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.70 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|