C8H12F4N2 — CID 129271421
1-methyl-4-[(Z)-1,3,3,3-tetrafluoroprop-1-enyl]piperazine (PubChem CID 129271421) has the molecular formula C8H12F4N2 and a molecular weight of 212.19 g/mol. Its IUPAC name is 1-methyl-4-[(Z)-1,3,3,3-tetrafluoroprop-1-enyl]piperazine.
| Compound Name | 1-methyl-4-[(Z)-1,3,3,3-tetrafluoroprop-1-enyl]piperazine |
|---|---|
| PubChem CID | 129271421 |
| Molecular Formula | C8H12F4N2 |
| Molecular Weight | 212.19 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 1-methyl-4-[(Z)-1,3,3,3-tetrafluoroprop-1-enyl]piperazine |
| SMILES | CN1CCN(/C(F)=C/C(F)(F)F)CC1 |
| InChI | InChI=1S/C8H12F4N2/c1-13-2-4-14(5-3-13)7(9)6-8(10,11)12/h6H,2-5H2,1H3/b7-6+ |
| InChIKey | NGQPSKSVUUSJTN-VOTSOKGWSA-N |
| XLogP | 1.61 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.19 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|