C8H8F8N2 — CID 129271427
1-(1,1,2,3,3-pentafluoroprop-2-enyl)-4-(trifluoromethyl)piperazine (PubChem CID 129271427) has the molecular formula C8H8F8N2 and a molecular weight of 284.15 g/mol. Its IUPAC name is 1-(1,1,2,3,3-pentafluoroprop-2-enyl)-4-(trifluoromethyl)piperazine.
| Compound Name | 1-(1,1,2,3,3-pentafluoroprop-2-enyl)-4-(trifluoromethyl)piperazine |
|---|---|
| PubChem CID | 129271427 |
| Molecular Formula | C8H8F8N2 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 1-(1,1,2,3,3-pentafluoroprop-2-enyl)-4-(trifluoromethyl)piperazine |
| SMILES | FC(F)=C(F)C(F)(F)N1CCN(C(F)(F)F)CC1 |
| InChI | InChI=1S/C8H8F8N2/c9-5(6(10)11)7(12,13)17-1-3-18(4-2-17)8(14,15)16/h1-4H2 |
| InChIKey | NFYNBNLJLMARFV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|