C29H34N4O12S — CID 129271492
(E)-3-[[2-[[2-[[(2S)-3-carboxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]acetyl]amino]-5-methylsulfonylpent-4-enoic acid (PubChem CID 129271492) has the molecular formula C29H34N4O12S and a molecular weight of 662.67 g/mol. Its IUPAC name is (E)-3-[[2-[[2-[[(2S)-3-carboxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]acetyl]amino]-5-methylsulfonylpent-4-enoic acid.
| Compound Name | (E)-3-[[2-[[2-[[(2S)-3-carboxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]acetyl]amino]-5-methylsulfonylpent-4-enoic acid |
|---|---|
| PubChem CID | 129271492 |
| Molecular Formula | C29H34N4O12S |
| Molecular Weight | 662.67 g/mol |
| Exact Mass | 662.19 |
| IUPAC Name | (E)-3-[[2-[[2-[[(2S)-3-carboxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]acetyl]amino]-5-methylsulfonylpent-4-enoic acid |
| SMILES | CS(=O)(=O)/C=C/C(CC(=O)O)NC(=O)CNC(=O)C(Cc1ccc(O)cc1)NC(=O)[C@H](CC(=O)O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H34N4O12S/c1-46(43,44)12-11-20(14-25(36)37)31-24(35)16-30-27(40)22(13-18-7-9-21(34)10-8-18)32-28(41)23(15-26(38)39)33-29(42)45-17-19-5-3-2-4-6-19/h2-12,20,22-23,34H,13-17H2,1H3,(H,30,40)(H,31,35)(H,32,41)(H,33,42)(H,36,37)(H,38,39)/b12-11+/t20?,22?,23-/m0/s1 |
| InChIKey | RRBGZZDPPXFRFJ-JSBQFNPNSA-N |
| XLogP | -0.18 |
| TPSA | 254.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.67 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |