C24H20F3N5O3 — CID 129271537
N-[4-methyl-3-(9-oxo-12-oxa-1,6,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-4-yl)phenyl]-2-(trifluoromethyl)pyridine-4-carboxamide (PubChem CID 129271537) has the molecular formula C24H20F3N5O3 and a molecular weight of 483.45 g/mol. Its IUPAC name is N-[4-methyl-3-(9-oxo-12-oxa-1,6,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-4-yl)phenyl]-2-(trifluoromethyl)pyridine-4-carboxamide.
| Compound Name | N-[4-methyl-3-(9-oxo-12-oxa-1,6,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-4-yl)phenyl]-2-(trifluoromethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 129271537 |
| Molecular Formula | C24H20F3N5O3 |
| Molecular Weight | 483.45 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | N-[4-methyl-3-(9-oxo-12-oxa-1,6,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-4-yl)phenyl]-2-(trifluoromethyl)pyridine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccnc(C(F)(F)F)c2)cc1-c1cnc2c(c1)N1CCOCC1C(=O)N2 |
| InChI | InChI=1S/C24H20F3N5O3/c1-13-2-3-16(30-22(33)14-4-5-28-20(9-14)24(25,26)27)10-17(13)15-8-18-21(29-11-15)31-23(34)19-12-35-7-6-32(18)19/h2-5,8-11,19H,6-7,12H2,1H3,(H,30,33)(H,29,31,34) |
| InChIKey | KXXVTZMVCMKMNG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |