C26H27F2N5O3 — CID 129271551
2-(1,1-difluoroethyl)-N-[3-(9-ethyl-8,12-dioxa-1,5,6-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl)-4-methylphenyl]pyridine-4-carboxamide (PubChem CID 129271551) has the molecular formula C26H27F2N5O3 and a molecular weight of 495.53 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-N-[3-(9-ethyl-8,12-dioxa-1,5,6-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl)-4-methylphenyl]pyridine-4-carboxamide.
| Compound Name | 2-(1,1-difluoroethyl)-N-[3-(9-ethyl-8,12-dioxa-1,5,6-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl)-4-methylphenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 129271551 |
| Molecular Formula | C26H27F2N5O3 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 2-(1,1-difluoroethyl)-N-[3-(9-ethyl-8,12-dioxa-1,5,6-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl)-4-methylphenyl]pyridine-4-carboxamide |
| SMILES | CCC1Oc2nnc(-c3cc(NC(=O)c4ccnc(C(C)(F)F)c4)ccc3C)cc2N2CCOCC12 |
| InChI | InChI=1S/C26H27F2N5O3/c1-4-22-21-14-35-10-9-33(21)20-13-19(31-32-25(20)36-22)18-12-17(6-5-15(18)2)30-24(34)16-7-8-29-23(11-16)26(3,27)28/h5-8,11-13,21-22H,4,9-10,14H2,1-3H3,(H,30,34) |
| InChIKey | WJMYPYQOVUMWRN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |