C28H29F2N5O3 — CID 129271573
2-(1,1-difluoroethyl)-N-[3-[(11S)-8-ethyl-9-oxo-13-oxa-1,6,8-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-4-yl]-4-methylphenyl]pyridine-4-carboxamide (PubChem CID 129271573) has the molecular formula C28H29F2N5O3 and a molecular weight of 521.57 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-N-[3-[(11S)-8-ethyl-9-oxo-13-oxa-1,6,8-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-4-yl]-4-methylphenyl]pyridine-4-carboxamide.
| Compound Name | 2-(1,1-difluoroethyl)-N-[3-[(11S)-8-ethyl-9-oxo-13-oxa-1,6,8-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-4-yl]-4-methylphenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 129271573 |
| Molecular Formula | C28H29F2N5O3 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 2-(1,1-difluoroethyl)-N-[3-[(11S)-8-ethyl-9-oxo-13-oxa-1,6,8-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-4-yl]-4-methylphenyl]pyridine-4-carboxamide |
| SMILES | CCN1C(=O)C[C@H]2COCCN2c2cc(-c3cc(NC(=O)c4ccnc(C(C)(F)F)c4)ccc3C)cnc21 |
| InChI | InChI=1S/C28H29F2N5O3/c1-4-34-25(36)14-21-16-38-10-9-35(21)23-11-19(15-32-26(23)34)22-13-20(6-5-17(22)2)33-27(37)18-7-8-31-24(12-18)28(3,29)30/h5-8,11-13,15,21H,4,9-10,14,16H2,1-3H3,(H,33,37)/t21-/m0/s1 |
| InChIKey | ZPYQHVFQGVJLIW-NRFANRHFSA-N |
| XLogP | 4.78 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |